C9H9Cl3N2O — CID 102751362
3-[(3,5,6-trichloro-2-pyridinyl)amino]cyclobutan-1-ol (PubChem CID 102751362) has the molecular formula C9H9Cl3N2O and a molecular weight of 267.54 g/mol. Its IUPAC name is 3-[(3,5,6-trichloro-2-pyridinyl)amino]cyclobutan-1-ol.
| Compound Name | 3-[(3,5,6-trichloro-2-pyridinyl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 102751362 |
| Molecular Formula | C9H9Cl3N2O |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 3-[(3,5,6-trichloro-2-pyridinyl)amino]cyclobutan-1-ol |
| SMILES | OC1CC(Nc2nc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C9H9Cl3N2O/c10-6-3-7(11)9(14-8(6)12)13-4-1-5(15)2-4/h3-5,15H,1-2H2,(H,13,14) |
| InChIKey | UHHDKWLJRUOPAJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|