C5H5Cl4N3 — CID 172553529
(3,5,6-trichloro-2-pyridinyl)hydrazine;hydrochloride (PubChem CID 172553529) has the molecular formula C5H5Cl4N3 and a molecular weight of 248.93 g/mol. Its IUPAC name is (3,5,6-trichloro-2-pyridinyl)hydrazine;hydrochloride.
| Compound Name | (3,5,6-trichloro-2-pyridinyl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 172553529 |
| Molecular Formula | C5H5Cl4N3 |
| Molecular Weight | 248.93 g/mol |
| Exact Mass | 246.92 |
| IUPAC Name | (3,5,6-trichloro-2-pyridinyl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C5H4Cl3N3.ClH/c6-2-1-3(7)5(11-9)10-4(2)8;/h1H,9H2,(H,10,11);1H |
| InChIKey | VQJZVXMTKQKDLR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.93 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|