C9H15Cl2N5 — CID 102762401
N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 102762401) has the molecular formula C9H15Cl2N5 and a molecular weight of 264.16 g/mol. Its IUPAC name is N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 102762401 |
| Molecular Formula | C9H15Cl2N5 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H15Cl2N5/c1-16(2)4-3-13-8-6(10)5-7(11)9(14-8)15-12/h5H,3-4,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | SONIAQDPYQWQTR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|