C10H12Cl2N6O — CID 106424765
3,5-dichloro-6-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 106424765) has the molecular formula C10H12Cl2N6O and a molecular weight of 303.15 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106424765 |
| Molecular Formula | C10H12Cl2N6O |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | Cc1noc(CCNc2nc(NN)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H12Cl2N6O/c1-5-15-8(19-18-5)2-3-14-9-6(11)4-7(12)10(16-9)17-13/h4H,2-3,13H2,1H3,(H2,14,16,17) |
| InChIKey | JUMGWWJLPYRDEZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|