C11H10Cl2N4O3 — CID 104917386
2,6-dichloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-nitroaniline (PubChem CID 104917386) has the molecular formula C11H10Cl2N4O3 and a molecular weight of 317.13 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 104917386 |
| Molecular Formula | C11H10Cl2N4O3 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2,6-dichloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-nitroaniline |
| SMILES | Cc1noc(CCNc2c(Cl)cc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C11H10Cl2N4O3/c1-6-15-10(20-16-6)2-3-14-11-8(12)4-7(17(18)19)5-9(11)13/h4-5,14H,2-3H2,1H3 |
| InChIKey | OEUHTUUUZKMYML-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|