C12H11N5O4 — CID 106418783
N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine (PubChem CID 106418783) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 106418783 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-5-nitro-1,3-benzoxazol-2-amine |
| SMILES | Cc1noc(CCNc2nc3cc([N+](=O)[O-])ccc3o2)n1 |
| InChI | InChI=1S/C12H11N5O4/c1-7-14-11(21-16-7)4-5-13-12-15-9-6-8(17(18)19)2-3-10(9)20-12/h2-3,6H,4-5H2,1H3,(H,13,15) |
| InChIKey | GQWAUWHRMHADRD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|