C11H9N5O4 — CID 106403985
5-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-benzoxazol-2-amine (PubChem CID 106403985) has the molecular formula C11H9N5O4 and a molecular weight of 275.22 g/mol. Its IUPAC name is 5-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 106403985 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2oc(NCCc3ncno3)nc2c1 |
| InChI | InChI=1S/C11H9N5O4/c17-16(18)7-1-2-9-8(5-7)15-11(19-9)12-4-3-10-13-6-14-20-10/h1-2,5-6H,3-4H2,(H,12,15) |
| InChIKey | ZNRXBAITSZYUPX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|