C12H13N3O4 — CID 115455192
[1-[[(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]methanol (PubChem CID 115455192) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is [1-[[(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]methanol.
| Compound Name | [1-[[(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115455192 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | [1-[[(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]methanol |
| SMILES | O=[N+]([O-])c1ccc2oc(NCC3(CO)CC3)nc2c1 |
| InChI | InChI=1S/C12H13N3O4/c16-7-12(3-4-12)6-13-11-14-9-5-8(15(17)18)1-2-10(9)19-11/h1-2,5,16H,3-4,6-7H2,(H,13,14) |
| InChIKey | PSFVGWXPUWNZGL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|