C12H9N3O3S — CID 112725928
5-nitro-N-(thiophen-2-ylmethyl)-1,3-benzoxazol-2-amine (PubChem CID 112725928) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 5-nitro-N-(thiophen-2-ylmethyl)-1,3-benzoxazol-2-amine.
| Compound Name | 5-nitro-N-(thiophen-2-ylmethyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 112725928 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 5-nitro-N-(thiophen-2-ylmethyl)-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2oc(NCc3cccs3)nc2c1 |
| InChI | InChI=1S/C12H9N3O3S/c16-15(17)8-3-4-11-10(6-8)14-12(18-11)13-7-9-2-1-5-19-9/h1-6H,7H2,(H,13,14) |
| InChIKey | CCZZQXYPAZKKAC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|