C11H13N3O4 — CID 79882875
N-(2-ethoxyethyl)-5-nitro-1,3-benzoxazol-2-amine (PubChem CID 79882875) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-(2-ethoxyethyl)-5-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79882875 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-(2-ethoxyethyl)-5-nitro-1,3-benzoxazol-2-amine |
| SMILES | CCOCCNc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C11H13N3O4/c1-2-17-6-5-12-11-13-9-7-8(14(15)16)3-4-10(9)18-11/h3-4,7H,2,5-6H2,1H3,(H,12,13) |
| InChIKey | CBPKJUINPDEIFP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|