About N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine
N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine (PubChem CID 79881765) has the molecular formula C12H16N4O3
and a molecular weight of 264.28 g/mol. Its IUPAC name is N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine |
| PubChem CID | 79881765 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine |
| SMILES | CCNCCCNc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C12H16N4O3/c1-2-13-6-3-7-14-12-15-10-5-4-9(16(17)18)8-11(10)19-12/h4-5,8,13H,2-3,6-7H2,1H3,(H,14,15) |
| InChIKey | TWMJYGVAAGKOHM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine?
The IUPAC name of N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine (CID 79881765) is N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine.
What is the SMILES notation for N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine?
The canonical SMILES for N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine is CCNCCCNc1nc2ccc([N+](=O)[O-])cc2o1.
What is the InChIKey of N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine?
The InChIKey is TWMJYGVAAGKOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O3/c1-2-13-6-3-7-14-12-15-10-5-4-9(16(17)18)8-11(10)19-12/h4-5,8,13H,2-3,6-7H2,1H3,(H,14,15).
What are the key properties of N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine?
N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine has a molecular weight of 264.28 g/mol, XLogP of 2.15, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(6-nitro-1,3-benzoxazol-2-yl)propane-1,3-diamine is sourced from PubChem (CID 79881765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).