C11H13N3O3 — CID 12711470
N-butyl-6-nitro-1,3-benzoxazol-2-amine (PubChem CID 12711470) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-butyl-6-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-butyl-6-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 12711470 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-butyl-6-nitro-1,3-benzoxazol-2-amine |
| SMILES | CCCCNc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C11H13N3O3/c1-2-3-6-12-11-13-9-5-4-8(14(15)16)7-10(9)17-11/h4-5,7H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | JRHAIGZOZOMIRK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|