C12H14N4O4 — CID 79882379
N,N-dimethyl-3-[(6-nitro-1,3-benzoxazol-2-yl)amino]propanamide (PubChem CID 79882379) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is N,N-dimethyl-3-[(6-nitro-1,3-benzoxazol-2-yl)amino]propanamide.
| Compound Name | N,N-dimethyl-3-[(6-nitro-1,3-benzoxazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 79882379 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N,N-dimethyl-3-[(6-nitro-1,3-benzoxazol-2-yl)amino]propanamide |
| SMILES | CN(C)C(=O)CCNc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C12H14N4O4/c1-15(2)11(17)5-6-13-12-14-9-4-3-8(16(18)19)7-10(9)20-12/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | RVFRAONRAYGQIC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|