C13H16N4O4 — CID 115356783
N-tert-butyl-2-[(6-nitro-1,3-benzoxazol-2-yl)amino]acetamide (PubChem CID 115356783) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is N-tert-butyl-2-[(6-nitro-1,3-benzoxazol-2-yl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(6-nitro-1,3-benzoxazol-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 115356783 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-tert-butyl-2-[(6-nitro-1,3-benzoxazol-2-yl)amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C13H16N4O4/c1-13(2,3)16-11(18)7-14-12-15-9-5-4-8(17(19)20)6-10(9)21-12/h4-6H,7H2,1-3H3,(H,14,15)(H,16,18) |
| InChIKey | JMFODWZMDMWEHM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|