C13H17N3O2 — CID 36581358
2-(1,3-benzoxazol-2-ylamino)-N-tert-butylacetamide (PubChem CID 36581358) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-N-tert-butylacetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-N-tert-butylacetamide |
|---|---|
| PubChem CID | 36581358 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CNc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H17N3O2/c1-13(2,3)16-11(17)8-14-12-15-9-6-4-5-7-10(9)18-12/h4-7H,8H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | LSBPHMJRUKPGHM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |