C16H14N2O3 — CID 81313394
2-[2-[(1,3-benzoxazol-2-ylamino)methyl]phenyl]acetic acid (PubChem CID 81313394) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[2-[(1,3-benzoxazol-2-ylamino)methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(1,3-benzoxazol-2-ylamino)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 81313394 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[2-[(1,3-benzoxazol-2-ylamino)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1CNc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H14N2O3/c19-15(20)9-11-5-1-2-6-12(11)10-17-16-18-13-7-3-4-8-14(13)21-16/h1-8H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | QUKZIBOUFMEVTA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |