C10H11ClN2O — CID 65027470
N-(2-chloropropyl)-1,3-benzoxazol-2-amine (PubChem CID 65027470) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is N-(2-chloropropyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(2-chloropropyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 65027470 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | N-(2-chloropropyl)-1,3-benzoxazol-2-amine |
| SMILES | CC(Cl)CNc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H11ClN2O/c1-7(11)6-12-10-13-8-4-2-3-5-9(8)14-10/h2-5,7H,6H2,1H3,(H,12,13) |
| InChIKey | IYVCIWASTHKGRD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|