C16H24N2O — CID 107816169
N-(7-methyloctyl)-1,3-benzoxazol-2-amine (PubChem CID 107816169) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(7-methyloctyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(7-methyloctyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 107816169 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(7-methyloctyl)-1,3-benzoxazol-2-amine |
| SMILES | CC(C)CCCCCCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H24N2O/c1-13(2)9-5-3-4-8-12-17-16-18-14-10-6-7-11-15(14)19-16/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3,(H,17,18) |
| InChIKey | WIBCVPKKGFAKEB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|