C14H20N2O — CID 79003498
N-(5-methylhexyl)-1,3-benzoxazol-2-amine (PubChem CID 79003498) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N-(5-methylhexyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(5-methylhexyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79003498 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-(5-methylhexyl)-1,3-benzoxazol-2-amine |
| SMILES | CC(C)CCCCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H20N2O/c1-11(2)7-5-6-10-15-14-16-12-8-3-4-9-13(12)17-14/h3-4,8-9,11H,5-7,10H2,1-2H3,(H,15,16) |
| InChIKey | HMSJIZWHMTXPLF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|