C12H15ClN2O — CID 66089941
N-(4-chloro-2-methylbutyl)-1,3-benzoxazol-2-amine (PubChem CID 66089941) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-chloro-2-methylbutyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 66089941 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-1,3-benzoxazol-2-amine |
| SMILES | CC(CCCl)CNc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H15ClN2O/c1-9(6-7-13)8-14-12-15-10-4-2-3-5-11(10)16-12/h2-5,9H,6-8H2,1H3,(H,14,15) |
| InChIKey | IOVFATIVGWTPFZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|