C15H13FN2O2 — CID 51086727
2-(1,3-benzoxazol-2-ylamino)-1-(2-fluorophenyl)ethanol (PubChem CID 51086727) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 51086727 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CNc1nc2ccccc2o1)c1ccccc1F |
| InChI | InChI=1S/C15H13FN2O2/c16-11-6-2-1-5-10(11)13(19)9-17-15-18-12-7-3-4-8-14(12)20-15/h1-8,13,19H,9H2,(H,17,18) |
| InChIKey | JVAGTENSEAGUSP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |