C14H11F4NO — CID 62810638
1-(2-fluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol (PubChem CID 62810638) has the molecular formula C14H11F4NO and a molecular weight of 285.24 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol.
| Compound Name | 1-(2-fluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol |
|---|---|
| PubChem CID | 62810638 |
| Molecular Formula | C14H11F4NO |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol |
| SMILES | OC(CNc1cc(F)c(F)c(F)c1)c1ccccc1F |
| InChI | InChI=1S/C14H11F4NO/c15-10-4-2-1-3-9(10)13(20)7-19-8-5-11(16)14(18)12(17)6-8/h1-6,13,19-20H,7H2 |
| InChIKey | NAOFQPLFYWYQJX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|