C14H10F5NO — CID 62811175
1-(2,5-difluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol (PubChem CID 62811175) has the molecular formula C14H10F5NO and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol |
|---|---|
| PubChem CID | 62811175 |
| Molecular Formula | C14H10F5NO |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(3,4,5-trifluoroanilino)ethanol |
| SMILES | OC(CNc1cc(F)c(F)c(F)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H10F5NO/c15-7-1-2-10(16)9(3-7)13(21)6-20-8-4-11(17)14(19)12(18)5-8/h1-5,13,20-21H,6H2 |
| InChIKey | PAZKWGYYMLFCHD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|