C10H13F2NO2 — CID 60969966
1-(2,5-difluorophenyl)-2-(ethoxyamino)ethanol (PubChem CID 60969966) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(ethoxyamino)ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(ethoxyamino)ethanol |
|---|---|
| PubChem CID | 60969966 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(ethoxyamino)ethanol |
| SMILES | CCONCC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H13F2NO2/c1-2-15-13-6-10(14)8-5-7(11)3-4-9(8)12/h3-5,10,13-14H,2,6H2,1H3 |
| InChIKey | LIZDQFYKLGESPF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|