C12H13F2NO — CID 114416982
2-(but-3-yn-2-ylamino)-1-(2,5-difluorophenyl)ethanol (PubChem CID 114416982) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(but-3-yn-2-ylamino)-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 2-(but-3-yn-2-ylamino)-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 114416982 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(but-3-yn-2-ylamino)-1-(2,5-difluorophenyl)ethanol |
| SMILES | C#CC(C)NCC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H13F2NO/c1-3-8(2)15-7-12(16)10-6-9(13)4-5-11(10)14/h1,4-6,8,12,15-16H,7H2,2H3 |
| InChIKey | SKRLCXNVLDWGBY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|