About 2-anilino-1-(2,5-difluorophenyl)ethanol
2-anilino-1-(2,5-difluorophenyl)ethanol (PubChem CID 55026297) has the molecular formula C14H13F2NO
and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-anilino-1-(2,5-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-anilino-1-(2,5-difluorophenyl)ethanol |
| PubChem CID | 55026297 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-anilino-1-(2,5-difluorophenyl)ethanol |
| SMILES | OC(CNc1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H13F2NO/c15-10-6-7-13(16)12(8-10)14(18)9-17-11-4-2-1-3-5-11/h1-8,14,17-18H,9H2 |
| InChIKey | OWVUDSVGOGVEDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-anilino-1-(2,5-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-1-(2,5-difluorophenyl)ethanol?
The IUPAC name of 2-anilino-1-(2,5-difluorophenyl)ethanol (CID 55026297) is 2-anilino-1-(2,5-difluorophenyl)ethanol.
What is the SMILES notation for 2-anilino-1-(2,5-difluorophenyl)ethanol?
The canonical SMILES for 2-anilino-1-(2,5-difluorophenyl)ethanol is OC(CNc1ccccc1)c1cc(F)ccc1F.
What is the InChIKey of 2-anilino-1-(2,5-difluorophenyl)ethanol?
The InChIKey is OWVUDSVGOGVEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO/c15-10-6-7-13(16)12(8-10)14(18)9-17-11-4-2-1-3-5-11/h1-8,14,17-18H,9H2.
What are the key properties of 2-anilino-1-(2,5-difluorophenyl)ethanol?
2-anilino-1-(2,5-difluorophenyl)ethanol has a molecular weight of 249.26 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-1-(2,5-difluorophenyl)ethanol is sourced from PubChem (CID 55026297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).