C14H13F2NO — CID 55026297
2-anilino-1-(2,5-difluorophenyl)ethanol (PubChem CID 55026297) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-anilino-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 2-anilino-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 55026297 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-anilino-1-(2,5-difluorophenyl)ethanol |
| SMILES | OC(CNc1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H13F2NO/c15-10-6-7-13(16)12(8-10)14(18)9-17-11-4-2-1-3-5-11/h1-8,14,17-18H,9H2 |
| InChIKey | OWVUDSVGOGVEDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |