C15H13F2NO3 — CID 60901510
2-(1,3-benzodioxol-5-ylamino)-1-(2,5-difluorophenyl)ethanol (PubChem CID 60901510) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 60901510 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-1-(2,5-difluorophenyl)ethanol |
| SMILES | OC(CNc1ccc2c(c1)OCO2)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H13F2NO3/c16-9-1-3-12(17)11(5-9)13(19)7-18-10-2-4-14-15(6-10)21-8-20-14/h1-6,13,18-19H,7-8H2 |
| InChIKey | DTCKLSGMIPMNFD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|