C15H14FNO3 — CID 60901511
2-(1,3-benzodioxol-5-ylamino)-1-(3-fluorophenyl)ethanol (PubChem CID 60901511) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-1-(3-fluorophenyl)ethanol.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-1-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 60901511 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-1-(3-fluorophenyl)ethanol |
| SMILES | OC(CNc1ccc2c(c1)OCO2)c1cccc(F)c1 |
| InChI | InChI=1S/C15H14FNO3/c16-11-3-1-2-10(6-11)13(18)8-17-12-4-5-14-15(7-12)20-9-19-14/h1-7,13,17-18H,8-9H2 |
| InChIKey | VMMXMDCYJYCKAW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|