C16H14FNO3 — CID 5298907
1-(1,3-benzodioxol-5-yl)-3-(3-fluoroanilino)propan-1-one (PubChem CID 5298907) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(3-fluoroanilino)propan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(3-fluoroanilino)propan-1-one |
|---|---|
| PubChem CID | 5298907 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(3-fluoroanilino)propan-1-one |
| SMILES | O=C(CCNc1cccc(F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14FNO3/c17-12-2-1-3-13(9-12)18-7-6-14(19)11-4-5-15-16(8-11)21-10-20-15/h1-5,8-9,18H,6-7,10H2 |
| InChIKey | FOAWUBNPRGKJKL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |