C16H14N2O5 — CID 4087773
3-(1,3-benzodioxol-5-ylamino)-1-(3-nitrophenyl)propan-1-one (PubChem CID 4087773) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(3-nitrophenyl)propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(3-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 4087773 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(3-nitrophenyl)propan-1-one |
| SMILES | O=C(CCNc1ccc2c(c1)OCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N2O5/c19-14(11-2-1-3-13(8-11)18(20)21)6-7-17-12-4-5-15-16(9-12)23-10-22-15/h1-5,8-9,17H,6-7,10H2 |
| InChIKey | AWYYBGWAWXNIPZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|