C15H11N3O5 — CID 590072
N-(1,3-benzodioxol-5-ylmethylideneamino)-3-nitrobenzamide (PubChem CID 590072) has the molecular formula C15H11N3O5 and a molecular weight of 313.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-3-nitrobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 590072 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-3-nitrobenzamide |
| SMILES | O=C(NN=Cc1ccc2c(c1)OCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N3O5/c19-15(11-2-1-3-12(7-11)18(20)21)17-16-8-10-4-5-13-14(6-10)23-9-22-13/h1-8H,9H2,(H,17,19) |
| InChIKey | XLJMHSDXIZKTAU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|