C15H10BrN3O5 — CID 3755684
N-[(4-bromo-3-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 3755684) has the molecular formula C15H10BrN3O5 and a molecular weight of 392.17 g/mol. Its IUPAC name is N-[(4-bromo-3-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(4-bromo-3-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3755684 |
| Molecular Formula | C15H10BrN3O5 |
| Molecular Weight | 392.17 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | N-[(4-bromo-3-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Br)c([N+](=O)[O-])c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H10BrN3O5/c16-11-3-1-9(5-12(11)19(21)22)7-17-18-15(20)10-2-4-13-14(6-10)24-8-23-13/h1-7H,8H2,(H,18,20) |
| InChIKey | PNLOSPQTOKXOQJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|