C17H13BrN4O6 — CID 6079730
N-[2-[(2Z)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 6079730) has the molecular formula C17H13BrN4O6 and a molecular weight of 449.22 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6079730 |
| Molecular Formula | C17H13BrN4O6 |
| Molecular Weight | 449.22 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | N-[2-[(2Z)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)N/N=C\c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13BrN4O6/c18-12-3-1-10(5-13(12)22(25)26)7-20-21-16(23)8-19-17(24)11-2-4-14-15(6-11)28-9-27-14/h1-7H,8-9H2,(H,19,24)(H,21,23)/b20-7- |
| InChIKey | RJZMWQABLPXMGM-SCDVKCJHSA-N |
| XLogP | 1.97 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|