C21H22BrN3O6 — CID 4017798
N-[2-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4017798) has the molecular formula C21H22BrN3O6 and a molecular weight of 492.33 g/mol. Its IUPAC name is N-[2-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4017798 |
| Molecular Formula | C21H22BrN3O6 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[2-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)CNC(=O)c2ccc3c(c2)OCO3)cc(Br)c1OCC |
| InChI | InChI=1S/C21H22BrN3O6/c1-3-28-18-8-13(7-15(22)20(18)29-4-2)10-24-25-19(26)11-23-21(27)14-5-6-16-17(9-14)31-12-30-16/h5-10H,3-4,11-12H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | KPSUQRBWFUZCCH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|