C23H24BrN3O8 — CID 4314952
ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-bromo-6-ethoxyphenoxy]acetate (PubChem CID 4314952) has the molecular formula C23H24BrN3O8 and a molecular weight of 550.36 g/mol. Its IUPAC name is ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-bromo-6-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-bromo-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 4314952 |
| Molecular Formula | C23H24BrN3O8 |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-bromo-6-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NNC(=O)CNC(=O)c2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C23H24BrN3O8/c1-3-31-19-8-14(7-16(24)22(19)33-12-21(29)32-4-2)10-26-27-20(28)11-25-23(30)15-5-6-17-18(9-15)35-13-34-17/h5-10H,3-4,11-13H2,1-2H3,(H,25,30)(H,27,28) |
| InChIKey | UFOOQYWWRLUTPP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|