C21H22BrFN2O5 — CID 126227618
ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126227618) has the molecular formula C21H22BrFN2O5 and a molecular weight of 481.32 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126227618 |
| Molecular Formula | C21H22BrFN2O5 |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=N/NC(=O)Cc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C21H22BrFN2O5/c1-3-28-18-10-15(9-17(22)21(18)30-13-20(27)29-4-2)12-24-25-19(26)11-14-5-7-16(23)8-6-14/h5-10,12H,3-4,11,13H2,1-2H3,(H,25,26)/b24-12+ |
| InChIKey | PZAFGBBCRUICSI-WYMPLXKRSA-N |
| XLogP | 3.62 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|