C20H20ClFN2O5 — CID 126242616
ethyl 2-[2-chloro-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 126242616) has the molecular formula C20H20ClFN2O5 and a molecular weight of 422.84 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126242616 |
| Molecular Formula | C20H20ClFN2O5 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=N/NC(=O)Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C20H20ClFN2O5/c1-3-28-19(26)12-29-20-16(21)8-14(9-17(20)27-2)11-23-24-18(25)10-13-4-6-15(22)7-5-13/h4-9,11H,3,10,12H2,1-2H3,(H,24,25)/b23-11+ |
| InChIKey | GAYWWORWMKCGMJ-FOKLQQMPSA-N |
| XLogP | 3.12 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|