C18H16BrClN2O5 — CID 19061289
2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid (PubChem CID 19061289) has the molecular formula C18H16BrClN2O5 and a molecular weight of 455.69 g/mol. Its IUPAC name is 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 19061289 |
| Molecular Formula | C18H16BrClN2O5 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc(Br)cc2)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C18H16BrClN2O5/c1-26-15-7-12(6-14(20)18(15)27-10-17(24)25)9-21-22-16(23)8-11-2-4-13(19)5-3-11/h2-7,9H,8,10H2,1H3,(H,22,23)(H,24,25)/b21-9- |
| InChIKey | YQNDLBXCZYCFGK-NKVSQWTQSA-N |
| XLogP | 3.27 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|