C18H24ClN3O5 — CID 126385152
2-[2-chloro-4-[(Z)-[[2-(cyclohexylamino)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126385152) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[[2-(cyclohexylamino)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(Z)-[[2-(cyclohexylamino)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126385152 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[[2-(cyclohexylamino)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=N\NC(=O)CNC2CCCCC2)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C18H24ClN3O5/c1-26-15-8-12(7-14(19)18(15)27-11-17(24)25)9-21-22-16(23)10-20-13-5-3-2-4-6-13/h7-9,13,20H,2-6,10-11H2,1H3,(H,22,23)(H,24,25)/b21-9- |
| InChIKey | NTHGZYSTXHGQSQ-NKVSQWTQSA-N |
| XLogP | 2.18 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|