C21H23ClN2O7 — CID 126365946
methyl 2-[2-chloro-4-[(E)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 126365946) has the molecular formula C21H23ClN2O7 and a molecular weight of 450.88 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[(E)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-4-[(E)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126365946 |
| Molecular Formula | C21H23ClN2O7 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 2-[2-chloro-4-[(E)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(/C=N/NC(=O)Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H23ClN2O7/c1-27-16-6-5-13(8-17(16)28-2)10-19(25)24-23-11-14-7-15(22)21(18(9-14)29-3)31-12-20(26)30-4/h5-9,11H,10,12H2,1-4H3,(H,24,25)/b23-11+ |
| InChIKey | GGGAPJFTSZPBSQ-FOKLQQMPSA-N |
| XLogP | 2.61 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|