C20H23BrN2O6 — CID 133169184
methyl 2-[2-bromo-4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 133169184) has the molecular formula C20H23BrN2O6 and a molecular weight of 467.32 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 133169184 |
| Molecular Formula | C20H23BrN2O6 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | methyl 2-[2-bromo-4-[(E)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(/C=N/NCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H23BrN2O6/c1-25-16-6-5-13(8-17(16)26-2)10-22-23-11-14-7-15(21)20(18(9-14)27-3)29-12-19(24)28-4/h5-9,11,22H,10,12H2,1-4H3/b23-11+ |
| InChIKey | GSYYRRYPYBWJNP-FOKLQQMPSA-N |
| XLogP | 3.15 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|