C23H22Br2N2O3 — CID 133171037
N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 133171037) has the molecular formula C23H22Br2N2O3 and a molecular weight of 534.25 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 133171037 |
| Molecular Formula | C23H22Br2N2O3 |
| Molecular Weight | 534.25 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C/c2ccc(OCc3ccc(Br)cc3)c(Br)c2)cc1OC |
| InChI | InChI=1S/C23H22Br2N2O3/c1-28-22-10-6-18(12-23(22)29-2)14-27-26-13-17-5-9-21(20(25)11-17)30-15-16-3-7-19(24)8-4-16/h3-13,27H,14-15H2,1-2H3/b26-13+ |
| InChIKey | NPCWNDVRGJGWLG-LGJNPRDNSA-N |
| XLogP | 5.93 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.25 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|