C23H22BrN3O5 — CID 133171038
N-[(E)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 133171038) has the molecular formula C23H22BrN3O5 and a molecular weight of 500.35 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(E)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 133171038 |
| Molecular Formula | C23H22BrN3O5 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C/c2ccc(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)cc1OC |
| InChI | InChI=1S/C23H22BrN3O5/c1-30-22-10-6-18(12-23(22)31-2)14-26-25-13-17-5-9-21(20(24)11-17)32-15-16-3-7-19(8-4-16)27(28)29/h3-13,26H,14-15H2,1-2H3/b25-13+ |
| InChIKey | ATGJLAGDMFZROE-DHRITJCHSA-N |
| XLogP | 5.08 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|