C25H26IN3O6 — CID 133171122
1-(3,4-dimethoxyphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]methanamine (PubChem CID 133171122) has the molecular formula C25H26IN3O6 and a molecular weight of 591.40 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]methanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]methanamine |
|---|---|
| PubChem CID | 133171122 |
| Molecular Formula | C25H26IN3O6 |
| Molecular Weight | 591.40 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]methanamine |
| SMILES | CCOc1cc(/C=N/NCc2ccc(OC)c(OC)c2)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H26IN3O6/c1-4-34-24-13-19(15-28-27-14-18-7-10-22(32-2)23(12-18)33-3)11-21(26)25(24)35-16-17-5-8-20(9-6-17)29(30)31/h5-13,15,27H,4,14,16H2,1-3H3/b28-15+ |
| InChIKey | ABNJAQQTYSMALY-RWPZCVJISA-N |
| XLogP | 5.32 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|