C21H25IN2O4 — CID 92658538
1-(3,4-dimethoxyphenyl)-N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]methanamine (PubChem CID 92658538) has the molecular formula C21H25IN2O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]methanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 92658538 |
| Molecular Formula | C21H25IN2O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylideneamino]methanamine |
| SMILES | C=CCOc1c(I)cc(/C=N\NCc2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H25IN2O4/c1-5-9-28-21-17(22)10-16(12-20(21)27-6-2)14-24-23-13-15-7-8-18(25-3)19(11-15)26-4/h5,7-8,10-12,14,23H,1,6,9,13H2,2-4H3/b24-14- |
| InChIKey | GVHVDABVUSVUAY-OYKKKHCWSA-N |
| XLogP | 4.40 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|