C25H25Cl2IN2O4 — CID 99945092
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 99945092) has the molecular formula C25H25Cl2IN2O4 and a molecular weight of 615.30 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 99945092 |
| Molecular Formula | C25H25Cl2IN2O4 |
| Molecular Weight | 615.30 g/mol |
| Exact Mass | 614.02 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | CCOc1cc(/C=N\NCc2ccc(OC)c(OC)c2)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H25Cl2IN2O4/c1-4-33-24-11-17(14-30-29-13-16-5-8-22(31-2)23(10-16)32-3)9-21(28)25(24)34-15-18-6-7-19(26)12-20(18)27/h5-12,14,29H,4,13,15H2,1-3H3/b30-14- |
| InChIKey | UCACVRXCIUOSKO-CPDSRJINSA-N |
| XLogP | 6.72 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.30 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|