C21H27ClN2O4 — CID 133169228
N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 133169228) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 133169228 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | CCCOc1c(Cl)cc(/C=N/NCc2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H27ClN2O4/c1-5-9-28-21-17(22)10-16(12-20(21)27-6-2)14-24-23-13-15-7-8-18(25-3)19(11-15)26-4/h7-8,10-12,14,23H,5-6,9,13H2,1-4H3/b24-14+ |
| InChIKey | FFILETVTRWMHLT-ZVHZXABRSA-N |
| XLogP | 4.67 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|