C25H26BrIN2O4 — CID 99945184
N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 99945184) has the molecular formula C25H26BrIN2O4 and a molecular weight of 625.30 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 99945184 |
| Molecular Formula | C25H26BrIN2O4 |
| Molecular Weight | 625.30 g/mol |
| Exact Mass | 624.01 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | CCOc1cc(/C=N\NCc2ccc(OC)c(OC)c2)cc(Br)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C25H26BrIN2O4/c1-4-32-24-13-19(11-21(26)25(24)33-16-17-5-8-20(27)9-6-17)15-29-28-14-18-7-10-22(30-2)23(12-18)31-3/h5-13,15,28H,4,14,16H2,1-3H3/b29-15- |
| InChIKey | FREOCUJVSGNAOS-FDVSRXAVSA-N |
| XLogP | 6.17 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.30 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|