C19H23IN2O4 — CID 92658176
1-(3,4-dimethoxyphenyl)-N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]methanamine (PubChem CID 92658176) has the molecular formula C19H23IN2O4 and a molecular weight of 470.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]methanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 92658176 |
| Molecular Formula | C19H23IN2O4 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]methanamine |
| SMILES | CCOc1c(I)cc(/C=N\NCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H23IN2O4/c1-5-26-19-15(20)8-14(10-18(19)25-4)12-22-21-11-13-6-7-16(23-2)17(9-13)24-3/h6-10,12,21H,5,11H2,1-4H3/b22-12- |
| InChIKey | WWANSWWGYCHCPR-UUYOSTAYSA-N |
| XLogP | 3.84 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|