C18H21IN2O3 — CID 17245629
N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245629) has the molecular formula C18H21IN2O3 and a molecular weight of 440.28 g/mol. Its IUPAC name is N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245629 |
| Molecular Formula | C18H21IN2O3 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | CCOc1c(I)cc(/C=N/NCc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C18H21IN2O3/c1-4-24-18-15(19)9-13(10-17(18)23-3)11-20-21-12-14-7-5-6-8-16(14)22-2/h5-11,21H,4,12H2,1-3H3/b20-11+ |
| InChIKey | VJNVYVTZTKATOX-RGVLZGJSSA-N |
| XLogP | 3.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|